Identification |
Name: | Ethanone,1-(5-chloro-2-thienyl)- |
Synonyms: | Ketone,5-chloro-2-thienyl methyl (6CI,7CI,8CI);1-(5-Chloro-2-thienyl)ethanone;1-(5-Chlorothiophen-2-yl)ethanone;2-Acetyl-5-chlorothiophene;2-Chloro-5-acetylthiophene;5-Chloro-2-acetylthiophene;NSC 43020; |
CAS: | 6310-09-4 |
EINECS: | 228-630-3 |
Molecular Formula: | C6H5 Cl O S |
Molecular Weight: | 160.62 |
InChI: | InChI=1/C6H5ClOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2811 |
Flash Point: | 227 °F |
Specification: | white to light yellow crystal powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Packinggroup: | III |
Flash Point: | 227 °F |
Sensitive: | Light Sensitive |
Safety Data |
|
 |