| Identification | |
| Name: | Dimethylvinylethinyl-p-hydroxyphenylmethane |
| Synonyms: | 4-(1-Ethynyl-3-methyl-2-butenyl)phenol |
| CAS: | 63141-79-7 |
| Molecular Formula: | C13H13O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H14O/c1-4-11(9-10(2)3)12-5-7-13(14)8-6-12/h1,5-9,11,14H,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 125.9°C |
| Boiling Point: | 283.2°C at 760 mmHg |
| Density: | 1.028g/cm3 |
| Refractive index: | 1.56 |
| Specification: |
Dimethylvinylethinyl-p-hydroxyphenylmethane , its cas register number is 63141-79-7. It also can be called p-Cresol, alpha-(2,2-dimethylvinyl)-alpha-ethynyl- ; and alpha-(2,2-Dimethylvinyl)-alpha-ethynyl-p-cresol . |
| Flash Point: | 125.9°C |
| Safety Data | |
 |
|
