| Identification | |
| Name: | trimethoxyborane |
| Synonyms: | Ai3-60245;Brn 1697939;Einecs 204-468-9;Hsdb 5589 |
| CAS: | 63156-11-6 |
| Molecular Formula: | C3H9BO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C3H9BO3/c1-5-4(6-2)7-3/h1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -29.3 deg C |
| Boiling Point: | 67.5 deg C |
| Solubility: | Miscible with tetrahydrofuran, ether, isoporpylamine, hexane, methanol, nujol, and other organic liquids Miscible with alcohol, ether; soluble in polar nonhydroxylic solvents |
| Color: | Colorless, moisture-sensitive liquid; fumes in air |
| Safety Data | |
 |
|
