Identification |
Name: | 2-Propenoic acid,3-(2,5-dihydroxyphenyl)-, methyl ester |
Synonyms: | Methyl 2,5-dihydroxycinnamate; |
CAS: | 63177-57-1 |
Molecular Formula: | C10H10O4 |
Molecular Weight: | 194.184 |
InChI: | InChI=1S/C10H10O4/c1-14-10(13)5-2-7-6-8(11)3-4-9(7)12/h2-6,11-12H,1H3/b5-2+ |
Molecular Structure: |
 |
Properties |
Density: | 1.318 g/cm3 |
Refractive index: | 1.628 |
Water Solubility: | 0.1 M NaOH: soluble in water |
Solubility: | 0.1 M NaOH: soluble in water |
Appearance: | crystalline |
Specification: | Yellow-Brown Crystalline Powder usageEng:A stable Erbstatin analogue that inhibits tyrosine kinase. Shown to delay the S-phase induction by epidermal growth factor in quiescent normal rat kidney cells, without affecting the total amount of DNA synthesis Safety Statements:22-26-36-45 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Storage Temperature: | −20°C |
Color: | yellow |
Usage: | A stable Erbstatin analogue that inhibits tyrosine kinase. Shown to delay the S-phase induction by epidermal growth factor in quiescent normal rat kidney cells, without affecting the total amount of DNA synthesis |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
 |