| Identification | |
| Name: | 1,4-Dioxaspiro[4.5]decane-2-methanol,9-methyl-6-(1-methylethyl)- |
| Synonyms: | FrescolatMGA;Menthone glycerin acetal;Menthone glyceryl ketal; |
| CAS: | 63187-91-7 |
| EINECS: | 408-200-3 |
| Molecular Formula: | C13H24O3 |
| Molecular Weight: | 228.32786 |
| InChI: | InChI=1S/C13H24O3/c1-9(2)12-5-4-10(3)6-13(12)15-8-11(7-14)16-13/h9-12,14H,4-8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 159.7 oC |
| Boiling Point: | 322.9 oC at 760 mmHg |
| Density: | 1.04 g/cm3 |
| Refractive index: | 1.488 |
| Water Solubility: | soluble in water, olive oil |
| Solubility: | soluble in water, olive oil <15% and almond oil 1% w/w |
| Appearance: | clear colourless viscous liquid |
| Specification: |
? 1,4-Dioxaspiro[4.5]decane-2-methanol,9-methyl-6-(1-methylethyl)- ,?its cas register number is 63187-91-7. It also can be called?6-Isopropyl-9-methyl-1,4-dioxaspiro(4.5)decane-2-methanol ; 9-Methyl-6-(1-methylethyl)-1,4-dioxaspiro(4.5)decane-2-methanol . 1,4-Dioxaspiro[4.5]decane-2-methanol,9-methyl-6-(1-methylethyl)- (CAS NO.63187-91-7) is harmful to aquatic organisms, and may cause long-term adverse effects in the aquatic environment. |
| Flash Point: | 159.7 oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
