| Identification | |
| Name: | 2-bromobenzenethiol |
| Synonyms: | Benzenethiol,o-bromo- (6CI,7CI,8CI);2-Bromobenzenethiol;2-Bromothiophenol;NSC 32016;o-Bromobenzenethiol;o-Bromothiophenol; |
| CAS: | 6320-02-1 |
| EINECS: | 228-665-4 |
| Molecular Formula: | C6H5BrS |
| Molecular Weight: | 189.0729 |
| InChI: | InChI=1S/C6H5BrS/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2922 |
| Density: | 1.573 |
| Refractive index: | 1.6345-1.6365 |
| Water Solubility: | immiscible with water |
| Solubility: | immiscible with water |
| Appearance: | clear yellow liquid |
| Specification: | clear yellow liquid Safety Statements:26-36-7/9 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 7/9:Keep container tightly closed and in a well-ventilated place |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Storage Temperature: | −20°C |
| Sensitive: | Stench |
| Color: | colorless to very deep yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
