| Identification | |
| Name: | cyometrinil |
| Synonyms: | Comcep;CGA 43089 |
| CAS: | 63278-33-1 |
| EINECS: | 264-063-8 |
| Molecular Formula: | C10H7N3O |
| Molecular Weight: | 185.18208 |
| InChI: | InChI=1/C10H7N3O/c11-6-7-14-13-10(8-12)9-4-2-1-3-5-9/h1-5H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.8°C |
| Boiling Point: | 322.4°C at 760 mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.553 |
| Specification: |
Benzeneacetonitrile,alpha-((cyanomethoxy)imino)- ,its cas register number is 63278-33-1.It also can be called alpha-((Cyanomethoxy)imino)benzeneacetonitrile ; (O-Cyanomethyl)oximinophenylacetonitrile ; Concep ; Cyometrinil and so on. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 148.8°C |
| Safety Data | |
 |
|
