| Identification | |
| Name: | 2,3-Dimethoxyquinoxaline |
| Synonyms: | quinoxaline, 2,3-dimethoxy-;NSC 38591; |
| CAS: | 6333-43-3 |
| Molecular Formula: | C10H10N2O2 |
| Molecular Weight: | 190.1986 |
| InChI: | InChI=1/C10H10N2O2/c1-13-9-10(14-2)12-8-6-4-3-5-7(8)11-9/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.203 g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
The 2,3-Dimethoxyquinoxaline with the cas number 6333-43-3, is also called quinoxaline, 2,3-dimethoxy-. The properties of the chemical are: (1)ACD/LogP: 1.03; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 44.24 Å2; (7)Index of Refraction: 1.594; (8)Molar Refractivity: 53.63 cm3; (9)Molar Volume: 158 cm3; (10)Polarizability: 21.26×10-24cm3; (11)Surface Tension: 46.5 dyne/cm; (12)Enthalpy of Vaporization: 48.09 kJ/mol; (13)Vapour Pressure: 0.0169 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
