| Identification |
| Name: | Hydrazine,(3,5-dichlorophenyl)-, hydrochloride (1:1) |
| Synonyms: | Hydrazine,(3,5-dichlorophenyl)-, monohydrochloride (9CI);(3,5-Dichlorophenyl)hydrazinehydrochloride;N-(3,5-Dichlorophenyl)hydrazine hydrochloride; |
| CAS: | 63352-99-8 |
| EINECS: | 264-109-7 |
| Molecular Formula: | C6H6Cl2N2.HCl |
| Molecular Weight: | 213.49 |
| InChI: | InChI=1/C6H6Cl2N2.ClH/c7-4-1-5(8)3-6(2-4)10-9;/h1-3,10H,9H2;1H |
| Molecular Structure: |
 |
| Properties |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white to light beige powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
