| Identification | |
| Name: | 6,12-Dihydroindolo(3,2-b)carbazole |
| Synonyms: | Indolo(3,2-b)carbazole, 6,12-dihydro-; |
| CAS: | 6336-32-9 |
| Molecular Formula: | C18H12N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C18H12N2/c1-3-7-15-11(5-1)13-9-18-14(10-17(13)19-15)12-6-2-4-8-16(12)20-18/h1-10,19-20H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.404 g/cm3 |
| Refractive index: | 1.923 |
| Specification: |
The Indolo[3,2-b]carbazole, its cas register number is 6336-32-9. It also can be called as Indolo(3,2-b)carbazole, 6,12-dihydro- and the IUPAC name about this chemicals is 5,11-Dihydroindolo[3,2-b]carbazole. Following are the chemical properties about Indolo[3,2-b]carbazole: (1)#H bond acceptors: 2; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 9.86Å2; (5)Index of Refraction: 1.923; (6)Molar Refractivity: 86.48 cm3; (7)Molar Volume: 182.5 cm3; (8)Polarizability: 34.28x10-24cm3; (9)Surface Tension: 77.6 dyne/cm; (10)Enthalpy of Vaporization: 82.31 kJ/mol; (11)Vapour Pressure: 2.08E-12 mmHg at 25°C This chemical can be described computed from structure: |
| Safety Data | |
 |
|
