| Identification | |
| Name: | 1,6-Hexamethylene diisocyanate, polymer with toluene diisocyanate |
| Synonyms: | Benzene, 1,3-diisocyanatomethyl-, polymer with 1,6-diisocyanatohexane;1,6-Hexamethylene diisocyanate, polymer with toluene diisocyanate;toluene diisocyanate/ hexamethylene diisocyanate copolymer;1,6-Hexamethylene diisocyanate, toluene diisocyanate polymer |
| CAS: | 63368-95-6 |
| Molecular Formula: | C17H18N4O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H6N2O2.C8H12N2O2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13;11-7-9-5-3-1-2-4-6-10-8-12/h2-4H,1H3;1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.5°C |
| Boiling Point: | 248.4°C at 760 mmHg |
| Flash Point: | 110.5°C |
| Safety Data | |
 |
|
