| Identification | |
| Name: | Benzene,1,2,3,4-tetrachloro- |
| Synonyms: | 1,2,3,4-Tetrachlorobenzene;NSC 50729 |
| CAS: | 634-66-2 |
| EINECS: | 211-214-0 |
| Molecular Formula: | C6H2 Cl4 |
| Molecular Weight: | 215.89 |
| InChI: | InChI=1/C6H2Cl4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3077 |
| Density: | 254 |
| Refractive index: | 1.582 |
| Solubility: | Slightly soluble in ethanol; very soluble in ether and carbon disulfide. In water, 5.92 mg/l at 25 deg C. |
| Specification: |
Simple aromatic halogenated organic compounds, such as 1,2,3,4-Tetrachlorobenzene, are very unreactive. Reactivity generally decreases with increased degree of substitution of halogen for hydrogen atoms. Materials in this group may be incompatible with strong oxidizing and reducing agents. Also, they may be incompatible with many amines, nitrides, azo/diazo compounds, alkali metals, and epoxides. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | O53 |
| Storage Temperature: | APPROX 4°C |
| Color: | Colorless needles |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
