| Identification |
| Name: | Guanidine, N-hydroxy-,sulfate (2:1) |
| Synonyms: | Guanidine,hydroxy-, sulfate (2:1) (salt) (8CI,9CI);Hydroxyguanidine hemisulfate;Hydroxyguanidine sulfate; |
| CAS: | 6345-29-5 |
| EINECS: | 228-749-0 |
| Molecular Formula: | C2H12N6O6S |
| Molecular Weight: | 75.0699 |
| InChI: | InChI=1/CH5N3O/c2-1(3)4-5/h5H,(H4,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.73 g/cm3 |
| Refractive index: | 1.602 |
| Appearance: | large white crystals |
| Storage Temperature: | 2-8°C |
| Usage: | Reacts with NO forming anadduct which is a potent and stable vasodilator. Its actions are very similar to those of NG-Hydroxy-L-arginine on the potentiation and stabilization of NO |
| Safety Data |
| |
 |
