Identification |
Name: | 4,4'-butane-1,4-diyl 1,1'-bis(4-methylpentyl) (2E,2'E)bis-but-2-enedioate |
Synonyms: | AC1O5OD6;2-Butenedioic acid (2E)-, 1-(4-methylpentyl) ester, diester with butanediol;2-Butenedioic acid (2E)-, mono(4-methylpentyl) ester, diester with butanediol;1-O-[4-[(E)-4-(4-methylpentoxy)-4-oxobut-2-enoyl]oxybutyl] 4-O-(4-methylpentyl) (E)-but-2-enedioate;63450-28-2 |
CAS: | 63450-28-2 |
Molecular Formula: | C24H38O8 |
Molecular Weight: | 454.5537 |
InChI: | InChI=1/C24H38O8/c1-19(2)9-7-17-31-23(27)13-11-21(25)29-15-5-6-16-30-22(26)12-14-24(28)32-18-8-10-20(3)4/h11-14,19-20H,5-10,15-18H2,1-4H3/b13-11+,14-12+ |
Molecular Structure: |
|
Properties |
Flash Point: | 223°C |
Boiling Point: | 529.4°C at 760 mmHg |
Density: | 1.065g/cm3 |
Refractive index: | 1.476 |
Flash Point: | 223°C |
Safety Data |
|
|