Identification |
Name: | 2-Butenedioic acid (2E)-, monohexyl ester, diester with butanediol |
Synonyms: | AC1O5OD9;2-Butenedioic acid (2E)-, monohexyl ester, diester with butanediol;2-Butenedioic acid (2E)-, 1-hexyl ester, diester with butanediol;4-O-[4-[(E)-4-hexoxy-4-oxobut-2-enoyl]oxybutyl] 1-O-hexyl (E)-but-2-enedioate;63450-29-3 |
CAS: | 63450-29-3 |
Molecular Formula: | C24H38O8 |
Molecular Weight: | 454.5537 |
InChI: | InChI=1/C24H38O8/c1-3-5-7-9-17-29-21(25)13-15-23(27)31-19-11-12-20-32-24(28)16-14-22(26)30-18-10-8-6-4-2/h13-16H,3-12,17-20H2,1-2H3/b15-13+,16-14+ |
Molecular Structure: |
 |
Properties |
Flash Point: | 226.5°C |
Boiling Point: | 537.3°C at 760 mmHg |
Density: | 1.067g/cm3 |
Refractive index: | 1.477 |
Flash Point: | 226.5°C |
Safety Data |
|
 |