| Identification |
| Name: | 3-nitrophthalic acid, compound with pyridine (1:1) |
| Synonyms: | 1,2-Benzenedicarboxylic acid, 3-nitro-, compd. with pyridine (1:1);Pyridine, 3-nitrophthalic acid salt;Pyridinium 3-nitrophthalate;3-Nitrophthalic acid, compound with pyridine (1:1);3-nitrobenzene-1,2-dicarboxylic acid - pyridine (1:1) |
| CAS: | 63451-32-1 |
| EINECS: | 264-194-0 |
| Molecular Formula: | C13H10N2O6 |
| Molecular Weight: | 290.2283 |
| InChI: | InChI=1/C8H5NO6.C5H5N/c10-7(11)4-2-1-3-5(9(14)15)6(4)8(12)13;1-2-4-6-5-3-1/h1-3H,(H,10,11)(H,12,13);1-5H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 199.4°C |
| Boiling Point: | 441.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 199.4°C |
| Safety Data |
| |
 |
