| Identification | |
| Name: | Benzaldehyde,4-methoxy-3-(phenylmethoxy)- |
| Synonyms: | Benzaldehyde,3-(benzyloxy)-4-methoxy- (6CI,8CI); 3-(Benzyloxy)-4-methoxybenzaldehyde;4-Methoxy-3-(phenylmethoxy)benzaldehyde; 4-Methoxy-3-benzyloxybenzaldehyde;Benzylisovanillin; Isovanillin benzyl ether; NSC 196547; NSC 43750;O-Benzylisovanillin |
| CAS: | 6346-05-0 |
| EINECS: | 228-752-7 |
| Molecular Formula: | C15H14 O3 |
| Molecular Weight: | 242.27 |
| InChI: | InChI=1/C15H14O3/c1-17-14-8-7-13(10-16)9-15(14)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 120 °C / 5mmHg |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | Slightly yellow solid. |
| Report: |
Removal in wastewater treatment of 3-Benzyloxy-4-methoxybenzaldehyde (6346-05-0) can be stated as follows: |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
