| Identification | |
| Name: | 4,4-Diethoxybutylamine |
| Synonyms: | Butyraldehyde,4-amino-, diethyl acetal (6CI,7CI,8CI);Butylamine, 4,4-diethoxy- (8CI);4,4-Diethoxy-1-butanamine;4-Aminobutanal diethylacetal;4-Aminobutyraldehyde diethyl acetal; |
| CAS: | 6346-09-4 |
| EINECS: | 228-753-2 |
| Molecular Formula: | C8H19NO2 |
| Molecular Weight: | 161.24 |
| InChI: | InChI=1/C8H19NO2/c1-3-10-8(11-4-2)6-5-7-9/h8H,3-7,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Density: | 0.909 |
| Refractive index: | n20/D 1.428(lit.) |
| Appearance: | colorless liquid |
| Specification: |
4,4-Diethoxybutylamine , with CAS number of 6346-09-4, can be called 1-Butanamine, 4,4-diethoxy- ; 4,4-diethoxy-1-butanamine;4-aminobutyralodehyde diethyl ester ; 4-aminobutyraldehyde diethyl acetal ; 4,4-diethoxybutylamine ; gamma-aminobutyraldehyde diethyl acetal ; 4-aminobutyraldehyde diethyl acetal, tech., 90% . It is a clear colourless liquid. |
| Packinggroup: | III |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
