| Identification | |
| Name: | p-phenylenebis[dithiocarbamic] acid, compound with triethylamine (1:2) |
| Synonyms: | Carbamodithioic acid, N,N'-1,4-phenylenebis-, compd. with N,N-diethylethanamine (1:2);Carbamodithioic acid, 1,4-phenylenebis-, compd. with N,N-diethylethanamine (1:2);p-Phenylenebis(dithiocarbamic) acid, compound with triethylamine (1:2);benzene-1,4-diyldicarbamodithioic acid - N,N-diethylethanamine (1:2) |
| CAS: | 63468-86-0 |
| EINECS: | 264-257-2 |
| Molecular Formula: | C20H38N4S4 |
| Molecular Weight: | 462.8025 |
| InChI: | InChI=1/C8H8N2S4.2C6H15N/c11-7(12)9-5-1-2-6(4-3-5)10-8(13)14;2*1-4-7(5-2)6-3/h1-4H,(H2,9,11,12)(H2,10,13,14);2*4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 177.3°C |
| Boiling Point: | 369.5°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 177.3°C |
| Safety Data | |
 |
|
