| Identification | |
| Name: | Benzoic acid,2-methoxy-5-(methylsulfonyl)-, methyl ester |
| Synonyms: | Methyl2-methoxy-5-(methylsulfonyl)benzoate |
| CAS: | 63484-12-8 |
| EINECS: | 264-267-7 |
| Molecular Formula: | C10H12 O5 S |
| Molecular Weight: | 244.29 |
| InChI: | InChI=1/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.126 g/cm3 |
| Refractive index: | 1.556 |
| Appearance: | yellowish fine powder |
| Specification: |
? Osthole , its cas register number is 484-12-8. It also can be called?7-Methoxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one ; 7-Methoxy-8-(3-methyl-2-butenyl)-coumarin ; 7-Methoxy-8-isopentenylcoumarin ; and 8-(3-Methyl-2-butenyl)herniarin .?Adjuvants, immunologic; Calcium channel blockers;?Cardiovascular Agents; Drug / Therapeutic Agent;?Immunologic Factors and Membrane Transport Modulators. |
| Safety Data | |
 |
|
