| Identification | |
| Name: | Hexachloro-m-xylene |
| Synonyms: | Hexachloro-m-xylene;63498-62-4;1,3-Dimethylbenzene hexachloro deriv.;AC1MILCG;1,3-Dimethylbenzene hexachloro deriv;LS-29894;Benzene, 1,3-dimethyl-, hexachloro deriv;Benzene, 1,3-dimethyl-, hexachloro deriv.;1,2,3,5-tetrachloro-4-(dichloromethyl)-6-methylbenzene |
| CAS: | 63498-62-4 |
| Molecular Formula: | C8H4Cl6 |
| Molecular Weight: | 312.8354 |
| InChI: | InChI=1/C8H4Cl6/c1-2-4(9)3(8(13)14)6(11)7(12)5(2)10/h8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 164.7°C |
| Boiling Point: | 345.5°C at 760 mmHg |
| Density: | 1.618g/cm3 |
| Refractive index: | 1.59 |
| Specification: |
Hexachloro-m-xylene , its cas register number is 63498-62-4. It also can be called 1,3-Dimethylbenzene hexachloro deriv. ; and Benzene, 1,3-dimethyl-, hexachloro deriv. . |
| Flash Point: | 164.7°C |
| Safety Data | |
 |
|
