| Identification | |
| Name: | 2-[(Diphenylmethyl) Thio] Acetic Acid |
| Synonyms: | 2-[(Diphenylmethyl)thio]-acetic acid; 2-PHENYL METHYLTHIO ACETIC ACID ; 2-[(DIPHENYLMETHYL)THIO]ACETIC ACID ; AKOS BC-1797 ; BENZHYDRYLSULFANYL ACETIC ACID ; (BENZHYDRYLTHIO)ACETIC ACID ; 2-(Diphenylmethyl)sulfide acetic acid ; AKOS BC-179; 2-[Diphenyl methyl-thio]-acetic acid; |
| CAS: | 63547-22-8 |
| Molecular Formula: | C15H14O2S |
| Molecular Weight: | 258.33 |
| InChI: | InChI=1/C15H14O2S/c16-14(17)11-18-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,16,17) |
| Molecular Structure: | ![(C15H14O2S) 2-[(Diphenylmethyl)thio]-acetic acid; 2-PHENYL METHYLTHIO ACETIC ACID ; 2-[(DIPHENYLMETHYL)THIO]ACET...](https://img.guidechem.com/casimg/63547-22-8.gif) |
| Properties | |
| Melting Point: | 127-1290C |
| Density: | 1.223g/cm3 |
| Refractive index: | 1.622 |
| Appearance: | White crystalline powder |
| Specification: |
2-[(Diphenylmethyl)thio]acetic acid , its CAS NO. is 63547-22-8, the synonyms are 2-(Diphenylmethyl)sulfide acetic acid ; AKOS BC-179 ; Acetic acid, [(diphenylmethyl)thio]- . |
| Usage: | Intermediate in the preparation of Modafinil |
| Safety Data | |
 |
|
