| Identification |
| Name: | Phenol,2-amino-4-chloro-6-nitro- |
| Synonyms: | 2-Amino-4-chloro-6-nitrophenol; |
| CAS: | 6358-08-3 |
| EINECS: | 228-761-6 |
| Molecular Formula: | C6H5ClN2O3 |
| Molecular Weight: | 188.57 |
| InChI: | InChI=1/C6H5ClN2O3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H,8H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 140.2°C |
| Boiling Point: | 308.3°C at 760 mmHg |
| Density: | 1.655g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.695 |
| Appearance: | solid |
| Flash Point: | 140.2°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Intermediate in the preparation of antipsychotics |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
