Identification |
Name: | N,N'-bis(isopropyl)urea, compound with sulphur trioxide (1:1) |
Synonyms: | Urea, N,N'-bis(1-methylethyl)-, compd. with sulfur trioxide (1:1);N,N'-Bis(isopropyl)urea, compound with sulphur trioxide (1:1);1,3-dipropan-2-ylurea - oxosulfane dioxide (1:1) |
CAS: | 63589-27-5 |
EINECS: | 264-349-2 |
Molecular Formula: | C7H16N2O4S |
Molecular Weight: | 224.2779 |
InChI: | InChI=1/C7H16N2O.O3S/c1-5(2)8-7(10)9-6(3)4;1-4(2)3/h5-6H,1-4H3,(H2,8,9,10); |
Molecular Structure: |
|
Properties |
Flash Point: | 113.3°C |
Boiling Point: | 265.4°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 113.3°C |
Safety Data |
|
|