| Identification | |
| Name: | 1,4-Benzenedicarboxylicacid, 1,4-diethyl ester |
| Synonyms: | 1,4-Benzenedicarboxylicacid, diethyl ester (9CI); Terephthalic acid, diethyl ester (6CI,7CI,8CI);Diethyl terephthalate; NSC 68816; p-Benzenedicarboxylic acid diethyl ester;p-Diethyl phthalate |
| CAS: | 636-09-9 |
| EINECS: | 211-249-1 |
| Molecular Formula: | C12H14 O4 |
| Molecular Weight: | 222.2372 |
| InChI: | InChI=1S/C12H14O4/c1-3-15-11(13)9-5-7-10(8-6-9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 42-45 °C |
| Flash Point: | 117 °C |
| Boiling Point: | 302 °C |
| Density: | 1.11 |
| Refractive index: | 1.507 |
| Specification: | white crystalline low melting solid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Flash Point: | 117 °C |
| Safety Data | |
 |
|
