| Identification | |
| Name: | 4(1H)-Pyrimidinone,2,3-dihydro-5-methyl-2-thioxo- |
| Synonyms: | Thymine,2-thio- (6CI,8CI); 2-Thiothymine; 4-Hydroxy-5-methyl-2-mercaptopyrimidine;4-Hydroxy-5-methylpyrimidine-2-thione; 5-Methyl-2-thiouracil;5-Methyl-2-thioxo-2,3-dihydro-1H-pyrimidin-4-one; NSC 314272; NSC 9377;Thiothymine |
| CAS: | 636-26-0 |
| Molecular Formula: | C5H6 N2 O S |
| Molecular Weight: | 142.18 |
| InChI: | InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.2°C |
| Boiling Point: | 329.7°C at 760 mmHg |
| Density: | 1.36 |
| Stability: | Stable but may be heat or light sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.638 |
| Solubility: | slight
|
| Appearance: | white crystalline powder |
| Specification: |
2-Thiothymine (CAS NO.636-26-0) is a white crystalline solid.It is insoluble in water.It is heat sensitive and may be light sensitive and it is probably combustible. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 153.2°C |
| Safety Data | |
 |
|
