| Identification | |
| Name: | Phenol,2-bromo-5-methoxy- |
| Synonyms: | 2-Bromo-5-methoxyphenol;4-Bromo-3-hydroxyanisole;QR BE EO1;phenol, 2-bromo-5-methoxy-; |
| CAS: | 63604-94-4 |
| Molecular Formula: | C7H7BrO2 |
| Molecular Weight: | 203.03 |
| InChI: | InChI=1/C7H7BrO2/c1-10-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.585g/cm3 |
| Refractive index: | 1.578 |
| Specification: |
The 2-Bromo-5-methoxyphenol, with the CAS registry number 63604-94-4, is also called phenol, 2-bromo-5-methoxy-. It belongs to the product categories of Blocks and Bromides. And the molecular formula of the chemical is C7H7BrO2. The characteristics of 2-Bromo-5-methoxyphenol are as followings: (1)ACD/LogP: 2.76; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.76; (4)ACD/LogD (pH 7.4): 2.68; (5)ACD/BCF (pH 5.5): 74; (6)ACD/BCF (pH 7.4): 60.68; (7)ACD/KOC (pH 5.5): 757.25; (8)ACD/KOC (pH 7.4): 621.02; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 29.46 Å2; (13)Index of Refraction: 1.578; (14)Molar Refractivity: 42.5 cm3; (15)Molar Volume: 128 cm3; (16)Polarizability: 16.84×10-24cm3; (17)Surface Tension: 43.8 dyne/cm; (18)Density: 1.585 g/cm3; (19)Flash Point: 107 °C; (20)Enthalpy of Vaporization: 51.06 kJ/mol; (21)Boiling Point: 253.3 °C at 760 mmHg; (22)Vapour Pressure: 0.0115 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
