| Identification | |
| Name: | Toluenediamine, propylene oxide polymer |
| Synonyms: | Toluenediamine, propylene oxide polymer 3-benzenediamine, ar-methyl- polymer with methyloxirane 3-benzenediamine, ar-methyl- polymer withmethyloxirane 1,3-Benzenediamine,ar-methyl-,polymer with methyloxirane Toluenediamine,propylene oxide polymer;1,3-Benzenediamine, ar-methyl-, polymer with methyloxirane |
| CAS: | 63641-63-4 |
| EINECS: | 500-158-5 |
| Molecular Formula: | C10H16N2O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H10N2.C3H6O/c1-5-6(8)3-2-4-7(5)9;1-3-2-4-3/h2-4H,8-9H2,1H3;3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.3°C |
| Boiling Point: | 284.2°C at 760 mmHg |
| Flash Point: | 148.3°C |
| Safety Data | |
 |
|
