| Identification | |
| Name: | Butophen |
| Synonyms: | ammonium 2-sec-butyl-4,6-dinitrophenolate;PHENOL,2-SEC-BUTYL-4,6-DINITRO-,AMMONIUMSALT;DINOSEBAMINE;1-(Ammonium oxy)-2-(1-methylpropyl)-4,6-dinitrobenzene |
| CAS: | 6365-83-9 |
| EINECS: | 228-858-3 |
| Molecular Formula: | C10H12N2O5 . H3N |
| Molecular Weight: | 257.2432 |
| InChI: | InChI=1/C10H12N2O5.H3N/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17;/h4-6,13H,3H2,1-2H3;1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 38-42 DEG C |
| Flash Point: | 132°C |
| Boiling Point: | 318.1°C at 760 mmHg |
| Density: | g/cm3 |
| Solubility: | 0.0052 G/100 G WATER; 48 G/100 G ETHANOL; 27 G/100 G N-HEPTANE; MISCIBLE IN ETHYL ETHER, TOLUENE, & XYLENE |
| Specification: |
Butophen (CAS NO.6365-83-9) is also called 2-(1-Methyl-n-propyl) 4,6-dinitrophenol, ammonium salt ; 2-sec-Butyl-4,6-dinitrophenol, ammonium salt ; 4,6-Dinitro-2-sec-butylphenol ammonium salt ; 4,6-Dinitro-2-sec.butylfenolate ammony ; 4,6-Dinitro-2-sec.butylfenolate ammony [Czech] ; 4,6-Dinitro-o-sec-butylphenol ammonium salt ; Chemox selective ; DNBP ammonium salt ; Dinoseb (amine) ; Dinoseb-ammonium ; Dinoterb-ammonium ; Dow selective ; Phenol, 2-sec-butyl-4,6-dinitro-, amine deriv. ; Selective ; Sinox W ; UNII-B5TNV5E10B . Butophen (CAS NO.6365-83-9) is high toxic. It will produce toxic nitrogen oxides and ammonia fumes by heat. So the storage environment should be ventilate, low-temperature and dry. Keep Butophen (CAS NO.6365-83-9) separate from raw materials of food. |
| Flash Point: | 132°C |
| Color: | Yellow crystals Orange solid |
| Safety Data | |
 |
|
