Identification |
Name: | Benzene, 1,2,4-trichloro- |
Synonyms: | 1,2,4-Trichlorobenzeneradical anion |
CAS: | 63697-18-7 |
Molecular Formula: | C6H3Cl3 |
Molecular Weight: | 181.45 |
InChI: | InChI=1S/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H |
Molecular Structure: |
 |
Properties |
Melting Point: | 17ºC |
Flash Point: | 200.1°C |
Boiling Point: | 210ºC |
Density: | 1.709g/cm3 |
Water Solubility: | Insoluble in water, slightly soluble in alcohol, soluble in ether, benzene and carbon bisulfide |
Solubility: | Insoluble in water, slightly soluble in alcohol, soluble in ether, benzene and carbon bisulfide |
Appearance: | Colorless transparent liquid crystalline solid below 17ºC |
Flash Point: | 200.1°C |
Color: | Colorless liquid Orthorhombic crystals Colorless liquid or crystalline solid (below 63 degrees F). |
Safety Data |
|
 |