| Identification | |
| Name: | Benzene, 1,2,4-trichloro- |
| Synonyms: | 1,2,4-Trichlorobenzeneradical anion |
| CAS: | 63697-18-7 |
| Molecular Formula: | C6H3Cl3 |
| Molecular Weight: | 181.45 |
| InChI: | InChI=1S/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 17ºC |
| Flash Point: | 200.1°C |
| Boiling Point: | 210ºC |
| Density: | 1.709g/cm3 |
| Water Solubility: | Insoluble in water, slightly soluble in alcohol, soluble in ether, benzene and carbon bisulfide |
| Solubility: | Insoluble in water, slightly soluble in alcohol, soluble in ether, benzene and carbon bisulfide |
| Appearance: | Colorless transparent liquid crystalline solid below 17ºC |
| Flash Point: | 200.1°C |
| Color: | Colorless liquid Orthorhombic crystals Colorless liquid or crystalline solid (below 63 degrees F). |
| Safety Data | |
 |
|
