| Identification | |
| Name: | 1,2-Aceanthrylenedione |
| Synonyms: | 1,2-Aceanthrenedione(6CI,7CI,8CI); Aceanthraquinone; Aceanthrenequinone; NSC 245130 |
| CAS: | 6373-11-1 |
| Molecular Formula: | C16H8 O2 |
| Molecular Weight: | 232.23 |
| InChI: | InChI=1/C16H8O2/c17-15-12-7-3-5-10-8-9-4-1-2-6-11(9)14(13(10)12)16(15)18/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 270-273 °C(lit.) |
| Flash Point: | 199.7°C |
| Boiling Point: | 462.6°C at 760 mmHg |
| Density: | 1.433g/cm3 |
| Refractive index: | 1.807 |
| Specification: |
Aceanthrenequinone , its cas register number is 6373-11-1. It also can be called 1,2-Aceanthrylenedione .It is a orange-red to orange-brown powder. |
| Flash Point: | 199.7°C |
| Safety Data | |
 |
|
