Identification |
Name: | 2-Propenoic acid, 2-hydroxyethyl ester, polymer with 1,1-dichloroethen e and methyl 2-propenoate |
Synonyms: | 2-Propenoic acid, 2-hydroxyethyl ester, polymer with 1,1-dichloroethen e and methyl 2-propenoate |
CAS: | 63744-63-8 |
Molecular Formula: | C11H16Cl2O5 |
Molecular Weight: | 299.14774 |
InChI: | InChI=1S/C5H8O3.C4H6O2.C2H2Cl2/c1-2-5(7)8-4-3-6;1-3-4(5)6-2;1-2(3)4/h2,6H,1,3-4H2;3H,1H2,2H3;1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 98.3°C |
Boiling Point: | 196.2°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 98.3°C |
Safety Data |
|
 |