| Identification | |
| Name: | Acetamide,N-(2-hydroxy-5-methylphenyl)- |
| Synonyms: | m-Acetotoluidide,6'-hydroxy- (8CI);2'-Hydroxy-5'-methylacetanilide;4-Methyl-6-acetamidophenol;N-(2-Hydroxy-5-methylphenyl)acetamide;NSC 158415; |
| CAS: | 6375-17-3 |
| EINECS: | 228-934-6 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.19 |
| InChI: | InChI=1/C9H11NO2/c1-6-3-4-9(12)8(5-6)10-7(2)11/h3-5,12H,1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.203 g/cm 3 |
| Stability: | No data. |
| Refractive index: | 1.604 |
| Appearance: | Solid |
| Specification: |
Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage.All chemicals should be considered hazardous. Avoid direct physical contact. Use appropriate, approved safety equipment. Untrained individuals should not handle this chemical or its container. Handling should occur in a chemical fume hood. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
