Identification |
Name: | Benzamide,2-[2-(diethylamino)ethoxy]-N-phenyl- |
Synonyms: | Benzanilide,2-[2-(diethylamino)ethoxy]- (7CI,8CI); 2-[2-(Diethylamino)ethoxy]benzanilide;Ajurac; Biospal; M 811; Salverine |
CAS: | 6376-26-7 |
EINECS: | 228-944-0 |
Molecular Formula: | C19H24 N2 O2 |
Molecular Weight: | 312.45 |
InChI: | InChI=1/C19H24N2O2/c1-3-21(4-2)14-15-23-18-13-9-8-12-17(18)19(22)20-16-10-6-5-7-11-16/h5-13H,3-4,14-15H2,1-2H3,(H,20,22) |
Molecular Structure: |
|
Properties |
Flash Point: | 193.8°C |
Boiling Point: | 396.9°C at 760 mmHg |
Density: | 1.107g/cm3 |
Refractive index: | 1.583 |
Specification: |
Salverine , its cas register number is 6376-26-7. It also can be called 2-(2-(Diethylamino)ethoxy)benzanilide ; O-(beta-Diethylaminoethyl)salicylanilid ; and Benzanilide, 2-(2-(diethylamino)ethoxy)- .
|
Flash Point: | 193.8°C |
Safety Data |
|
|