| Identification | |
| Name: | Acetamide,N-[2-(6-chloro-5-methoxy-1H-indol-3-yl)ethyl]- |
| Synonyms: | 6-Chloromelatonin |
| CAS: | 63762-74-3 |
| Molecular Formula: | C13H15 Cl N2 O2 |
| Molecular Weight: | 266.72 |
| InChI: | InChI=1/C13H15ClN2O2/c1-8(17)15-4-3-9-7-16-12-6-11(14)13(18-2)5-10(9)12/h5-7,16H,3-4H2,1-2H3,(H,15,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 278.4°C |
| Boiling Point: | 536.7°C at 760 mmHg |
| Density: | 1.272g/cm3 |
| Refractive index: | 1.608 |
| Specification: | Safety Statements:53-26-36/37/39-45 53:Avoid exposure - obtain special instruction before use 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Biological Activity: | Potent melatonin agonist (pK i values are 9.10 and 9.77 for human recombinant MT 1 and MT 2 receptors respectively). Displays higher affinity for binding to hamster brain membrane and chicken retina than melatonin. |
| Flash Point: | 278.4°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
