Identification |
Name: | Benzo[h][1]benzopyrano[5,4,3-cde][1]benzopyran-5,12-dione,10-[[6-deoxy-2-O-(6-deoxy-3-O-methyl-a-D-galactopyranosyl)-b-D-galactopyranosyl]oxy]-6-hydroxy-1-methyl- |
Synonyms: | Chartreusin(7CI,8CI); Antibiotic X 465A; Lambdamycin; NSC 5159 |
CAS: | 6377-18-0 |
Molecular Formula: | C32H32 O14 |
Molecular Weight: | 640.64 |
InChI: | InChI=1/C32H32O14/c1-10-8-9-15-18-16(10)29(38)45-26-17-13(23(35)20(19(18)26)30(39)43-15)6-5-7-14(17)44-32-28(24(36)21(33)11(2)42-32)46-31-25(37)27(40-4)22(34)12(3)41-31/h5-9,11-12,21-22,24-25,27-28,31-37H,1-4H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 307.8°C |
Boiling Point: | 945.5°C at 760 mmHg |
Density: | 1.63g/cm3 |
Refractive index: | 1.718 |
Specification: |
The classification code of Chartreusin (CAS NO.6377-18-0 ) are antibiotics, antineoplastic, antineoplastic agents, Drug / therapeutic agent and mutation data.
|
Flash Point: | 307.8°C |
Safety Data |
|
|