| Identification |
| Name: | 2-Butenoic acid,3-methyl-, ethyl ester |
| Synonyms: | Senecioic acid, ethyl ester (6CI);3-Methyl-2-butenoic acid ethyl ester;Ethyl 3,3-dimethylacrylate;Ethyl3-methyl-2-butenoate;Ethyl 3-methylcrotonate;Ethyl dimethylacrylate;Ethylisobutenoate;Ethyl isopropylideneacetate;Ethyl senecioate;Ethyl b,b-dimethylacrylate;Ethyl b-methylcrotonate;NSC 61853;NSC 99208;Crotonicacid, 3-methyl-, ethyl ester (7CI,8CI); |
| CAS: | 638-10-8 |
| EINECS: | 211-319-1 |
| Molecular Formula: | C7H12O2 |
| Molecular Weight: | 128.17 |
| InChI: | InChI=1/C7H12O2/c1-4-9-7(8)5-6(2)3/h5H,4H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3272 |
| Flash Point: | 93? |
| Density: | 0.922 |
| Stability: | Stable. Flammable. Incompatible with acids, bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.436 |
| Solubility: | Insoluble |
| Appearance: | colorless liquid |
| Packinggroup: | III |
| Flash Point: | 93? |
| Storage Temperature: | Keep tightly closed. Keep away from heat, sparks, and open flame. Store in a cool dry place. |
| Usage: | Food additive for flavor. |
| Safety Data |
| |
 |
