| Identification | |
| Name: | ISOEUGENYLMETHYLETHER |
| Synonyms: | (Z)-Methylisoeugenol;(Z)-O-Methylisoeugenol;1,2-Dimethoxy-4-[(Z)-1-propenyl]benzene;4-cis-Propenylveratrole;cis-Isoeugenol methyl ether |
| CAS: | 6380-24-1 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.22766 |
| InChI: | InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 |
| Molecular Structure: | ![(C11H14O2) (Z)-Methylisoeugenol;(Z)-O-Methylisoeugenol;1,2-Dimethoxy-4-[(Z)-1-propenyl]benzene;4-cis-Propenylve...](https://img.guidechem.com/structure/6380-24-1.gif) |
| Properties | |
| Melting Point: | -4 deg C |
| Boiling Point: | 254.7 deg C |
| Solubility: | Soluble in most organic solvents Soluble in ethanol, ethyl ether Soluble in fixed oils; insoluble in glycerin and propylene glycol In water, 500 mg/L at 25 deg C |
| Color: | Crystals from hexane Colorless to pale yellow liquid |
| Safety Data | |
 |
|
