| Identification | |
| Name: | Phenol,2-methyl-5-(1-methylethyl)-, 1-acetate |
| Synonyms: | Carvacrol,acetate (8CI);Phenol, 2-methyl-5-(1-methylethyl)-, acetate (9CI);Carvacrylacetate;NSC 6601; |
| CAS: | 6380-28-5 |
| EINECS: | 228-963-4 |
| Molecular Formula: | C12H16O2 |
| Molecular Weight: | 192.25 |
| InChI: | InChI=1/C12H16O2/c1-8(2)11-6-5-9(3)12(7-11)14-10(4)13/h5-8H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.994 g/cm3 |
| Refractive index: | 1.497 |
| Specification: |
The Carvacryl acetate with the CAS number 6380-28-5 is also called Phenol,2-methyl-5-(1-methylethyl)-, 1-acetate. The IUPAC name is (2-methyl-5-propan-2-ylphenyl) acetate. Its EINECS registry number is 228-963-4. The molecular formula is C12H16O2. The properties of the chemical are: (1)ACD/LogP: 3.35; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.35; (4)ACD/LogD (pH 7.4): 3.35; (5)ACD/BCF (pH 5.5): 208.52; (6)ACD/BCF (pH 7.4): 208.52; (7)ACD/KOC (pH 5.5): 1590.96; (8)ACD/KOC (pH 7.4): 1590.96; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 26.3Å2; (13)Index of Refraction: 1.497; (14)Molar Refractivity: 56.6 cm3; (15)Molar Volume: 193.4 cm3; (16)Polarizability: 22.43×10-24cm3; (17)Surface Tension: 32.4 dyne/cm; (18)Enthalpy of Vaporization: 48.41 kJ/mol; (19)Vapour Pressure: 0.0263 mmHg at 25°C. Uses: This chemical can prepare 5-isopropyl-2-methyl-phenol. This reaction needs catalyst TsOH/SiO2, solvent toluene and H2O at temperature of 80 °C. The reaction time is 18 hours. The yield is 94%. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
