| Identification | |
| Name: | Methanone,(4-methylphenyl)-4-morpholinyl- |
| Synonyms: | Morpholine,4-(4-methylbenzoyl)- (9CI); Morpholine, 4-p-toluoyl- (6CI);4-(4-Methylbenzoyl)morpholine; N-(4-Methylbenzoyl)morpholine; NSC 38132 |
| CAS: | 63833-44-3 |
| Molecular Formula: | C12H15 N O2 |
| Molecular Weight: | 205.25 |
| InChI: | InChI=1/C12H15NO2/c1-10-2-4-11(5-3-10)12(14)13-6-8-15-9-7-13/h2-5H,6-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 73-74 ºC |
| Flash Point: | 175.7°C |
| Boiling Point: | 366.8°C at 760 mmHg |
| Density: | 1.128g/cm3 |
| Refractive index: | 1.551 |
| Specification: |
The (4-Methylphenyl)morpholin-4-ylmethanone with the cas number 63833-44-3, is also called Morpholin-4-yl-p-tolyl-methanone .This product can be supplied by the following suppliers: (1)Wuhan Enyu Technology Development Co., Ltd.; (2)Atomax Chemicals Co., Ltd.; (3)ChangChem Co., Ltd.; (4)Water Chemical Co., Ltd.. The properties of the chemical are: (1)#H bond acceptors: 3 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 29.54 Å2 ; (5)Index of Refraction: 1.551 ; (6)Molar Refractivity: 58.08 cm3 ; (7)Molar Volume: 181.8 cm3 ; (8)Polarizability: 23.02×10-24cm3 ; (9)Surface Tension: 42.5 dyne/cm ; (10)Enthalpy of Vaporization: 61.33 kJ/mol ; (11)Vapour Pressure: 1.42×10-5 mmHg at 25°C . You can still convert the following datas into molecular structure : |
| Flash Point: | 175.7°C |
| Safety Data | |
 |
|
