| Identification |
| Name: | ethyl prop-2-enoate; 4-hydroxybutyl prop-2-enoate; methyl 2-methylprop-2-enoate |
| Synonyms: | AC1O5A0K;Butanediol monoacrylate, methyl methacrylate, ethyl acrylate polymer;ethyl prop-2-enoate; 4-hydroxybutyl prop-2-enoate; methyl 2-methylprop-2-enoate;2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethyl 2-propenoate and 4-hydroxybutyl 2-propenoate;63833-84-1 |
| CAS: | 63833-84-1 |
| Molecular Formula: | C17H28O7 |
| Molecular Weight: | 344.4 |
| InChI: | InChI=1/C7H12O3.2C5H8O2/c1-2-7(9)10-6-4-3-5-8;1-4(2)5(6)7-3;1-3-5(6)7-4-2/h2,8H,1,3-6H2;1H2,2-3H3;3H,1,4H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 86.6°C |
| Boiling Point: | 298.1°C at 760 mmHg |
| Flash Point: | 86.6°C |
| Safety Data |
| |
 |
