| Identification | |
| Name: | Dietrol |
| Synonyms: | Dietrol;Hourbese;Reducto;Trimstat;Trimtabs;Obepar;Neo-nilorex;3,4-Dimethyl-2-phenylmorpholine bitartrate;Morpholine, 3,4-dimethyl-2-phenyl-, bitartrate;AC1O64V4;LS-92784;phendimetrazine tartrate, (R-(R*,R*))-isomer;(2R,3R)-2,3-dihydroxybutanedioic acid; 3,4-dimethyl-2-phenylmorpholine;63868-62-2 |
| CAS: | 63868-62-2 |
| Molecular Formula: | C12H17NO . 2C4H6O6 |
| Molecular Weight: | 491.4432 |
| InChI: | InChI=1/C12H17NO.2C4H6O6/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11;2*5-1(3(7)8)2(6)4(9)10/h3-7,10,12H,8-9H2,1-2H3;2*1-2,5-6H,(H,7,8)(H,9,10)/t;2*1-,2-/m.11/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 80.9°C |
| Boiling Point: | 275.3°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Dietrol , its cas register number is 63868-62-2. It also can be called Phendimetrazine bitartrate ; 3,4-Dimethyl-2-phenylmorpholine bitartrate ; Bacarate ; and Morpholine, 3,4-dimethyl-2-phenyl-, bitartrate . |
| Flash Point: | 80.9°C |
| Safety Data | |
 |
|
