| Identification | |
| Name: | Chloro(dibutoxyphosphinyl)Mercury |
| Synonyms: | Mercury chloride, (dibutoxyphosphinyl)-;MERCURY, CHLORO(DIBUTOXYPHOSPHINYL)-;LS-89704;63869-01-2 |
| CAS: | 63869-01-2 |
| Molecular Formula: | C8H18ClHgO3P |
| Molecular Weight: | 430.2514 |
| InChI: | InChI=1/C8H19O3P.ClH.Hg/c1-3-5-7-10-12(9)11-8-6-4-2;;/h12H,3-8H2,1-2H3;1H;/q;;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 121.1°C |
| Boiling Point: | 247.7°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Chloro(dibutoxyphosphinyl)Mercury , its cas register number is 63869-01-2. It also can be called Mercury chloride, (dibutoxyphosphinyl)- . Its classification code is Organometallic. |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 121.1°C |
| Safety Data | |
 |
|
