| Identification | |
| Name: | Carbamic acid,dimethyl-, 2-[(diethylamino)methyl]phenyl ester, monohydrochloride (9CI) |
| Synonyms: | AR-39;Dimethylcarbamic ester of 2-oxybenzyldiethylamine hydrochloride;Carbamic acid, dimethyl-, (alpha-(diethylamino))-o-tolyl ester, hydrochloride;CARBAMIC ACID, N,N-DIMETHYL-, 2-(DIETHYLAMINOMETHYL)PHENYL ESTER, HYDROCHLORIDE;63884-67-3;AC1L2CVY;LS-49463;[2-(dimethylcarbamoyloxy)phenyl]methyl-diethylazanium chloride;N-{2-[(dimethylcarbamoyl)oxy]benzyl}-N-ethylethanaminium chloride |
| CAS: | 63884-67-3 |
| Molecular Formula: | C14H22 N2 O2 . Cl H |
| Molecular Weight: | 286.84 |
| InChI: | InChI=1/C14H22N2O2.ClH/c1-5-16(6-2)11-12-9-7-8-10-13(12)18-14(17)15(3)4;/h7-10H,5-6,11H2,1-4H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.8°C |
| Boiling Point: | 329.1°C at 760 mmHg |
| Specification: |
Dimethylcarbamic ester of 2-oxybenzyldiethylamine hydrochloride , its cas register number is 63884-67-3. It also can be called AR-39 ; Carbamic acid, N,N-dimethyl-, 2-(diethylaminomethyl)phenyl ester, hydrochloride ; and Carbamic acid, dimethyl-, (alpha-(diethylamino))-o-tolyl ester, hydrochloride . |
| Flash Point: | 152.8°C |
| Safety Data | |
 |
|
