| Identification | |
| Name: | Carbamic acid,dimethyl-, 4-[2-(dimethylamino)ethyl]phenyl ester, monohydrochloride (9CI) |
| Synonyms: | 4-[2-(Dimethylamino)ethyl]phenyl dimethylcarbamate hydrochloride (1:1);carbamic acid, N,N-dimethyl-, 4-[2-(dimethylamino)ethyl]phenyl ester, hydrochloride (1:1) |
| CAS: | 63884-71-9 |
| Molecular Formula: | C13H20 N2 O2 . Cl H |
| Molecular Weight: | 272.81 |
| InChI: | InChI=1/C13H20N2O2.ClH/c1-14(2)10-9-11-5-7-12(8-6-11)17-13(16)15(3)4;/h5-8H,9-10H2,1-4H3;1H |
| Molecular Structure: | ![(C13H20N2O2.ClH) 4-[2-(Dimethylamino)ethyl]phenyl dimethylcarbamate hydrochloride (1:1);carbamic acid, N,N-dimethyl-,...](https://img1.guidechem.com/chem/e/dict/89/63884-71-9.jpg) |
| Properties | |
| Flash Point: | 152.2°C |
| Boiling Point: | 328.1°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
AR-41 , its cas register number is 63884-71-9. It also can be called Carbamic acid, N,N-dimethyl-, 4-(beta-dimethylaminoethyl)phenyl ester, hydrochloride ; Phenethylamine, N,N-dimethyl-p-(N',N'-dimethylcarbamoyloxy)-, hydrochloride ; and Dimethylcarbamic ester of hordenine hydrochloride . |
| Flash Point: | 152.2°C |
| Safety Data | |
 |
|
