| Identification | |
| Name: | Plumbane,triethyl[(1-oxo-9-octadecenyl)oxy]-, (Z)- (9CI) |
| Synonyms: | Oleic acid=triethyllead(IV) salt |
| CAS: | 63916-98-3 |
| Molecular Formula: | C24H48 O2 Pb |
| Molecular Weight: | 575.91 |
| InChI: | InChI=1/C18H34O2.3C2H5.Pb/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*1-2;/h9-10H,2-8,11-17H2,1H3,(H,19,20);3*1H2,2H3;/b10-9-;;;;/rC18H34O2.C6H15Pb/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-7(5-2)6-3/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-6H2,1-3H3/b10-9-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Triethyllead oleate , its cas register number is 63916-98-3. It also can be called Lead, triethyl-, oleate . |
| Report: |
Lead and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 270.1°C |
| Safety Data | |
 |
|
