| Identification | |
| Name: | Ethyl-beta-chloroethyl-ethylenimonium picrylsulfonate |
| Synonyms: | Ethyl-beta-chloroethyl-ethylenimonium picrylsulfonate;1-Ethyl-1-(beta-chloroethyl)ethylenimonium picrylsulfonate;ETHYLENIMONIUM, ETHYL(2-CHLOROETHYL)-, PICRYLSULFONATE;63918-55-8;AC1L2DWI;LS-68558;1-(2-chloroethyl)-2-ethylaziridinium 2,4,6-trinitrobenzenesulfonate;1-(2-chloroethyl)-2-ethylaziridin-1-ium; 2,4,6-trinitrobenzenesulfonate |
| CAS: | 63918-55-8 |
| Molecular Formula: | C6H13ClN . C6H2N3O9S |
| Molecular Weight: | 426.7869 |
| InChI: | InChI=1/C6H12ClN.C6H3N3O9S/c1-2-6-5-8(6)4-3-7;10-7(11)3-1-4(8(12)13)6(19(16,17)18)5(2-3)9(14)15/h6H,2-5H2,1H3;1-2H,(H,16,17,18) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Ethyl-beta-chloroethyl-ethylenimonium picrylsulfonate , its cas register number is 63918-55-8. It also can be called 1-Ethyl-1-(beta-chloroethyl)ethylenimonium picrylsulfonate . When Ethyl-beta-chloroethyl-ethylenimonium picrylsulfonate (CAS NO.63918-55-8) is heated to decomposition, it emits very toxic fumes of Cl−, NOx and SOx. |
| Flash Point: | °C |
| Safety Data | |
 |
|
