| Identification | |
| Name: | 4-Amino-3-nitrobenzonitrile |
| Synonyms: | 4-amino-3-nitro-benzonitrile;3-Nitro-4-Aminobenzonitrile; |
| CAS: | 6393-40-4 |
| Molecular Formula: | C7H5N3O2 |
| Molecular Weight: | 163.13 |
| InChI: | InChI=1/C7H5N3O2/c8-4-5-1-2-6(9)7(3-5)10(11)12/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.41 g/cm3 |
| Refractive index: | 1.626 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
4-Amino-3-nitrobenzonitrile , its cas register number is 6393-40-4. It also can be called 4-amino-3-nitro-benzonitrile ; 3-Nitro-4-Aminobenzonitrile .It is a white to light yellow crystal powder. |
| Packinggroup: | III |
| Usage: | Gamma irradiations effect on release of 4-amino-3-nitrobenzonitrile from polyanhydride matrixes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
