| Identification | |
| Name: | 2-Cyclopenten-1-one,2-hydroxy-5-methylene-3-(1-piperidinylamino)- |
| Synonyms: | 2-Hydroxy-5-methylene-3-(piperidinoamino)-2-cyclopenten-1-one;APIP |
| CAS: | 63937-31-5 |
| Molecular Formula: | C11H16 N2 O2 |
| Molecular Weight: | 208.29 |
| InChI: | InChI=1/C11H16N2O2/c1-8-7-9(11(15)10(8)14)12-13-5-3-2-4-6-13/h12,15H,1-7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 166.3°C |
| Boiling Point: | 351.4°Cat760mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.586 |
| Specification: |
Anhydro-piperidino hexose reductone ,its CAS number is 63937-31-5,it can be called 2-cyclopenten-1-one, 2-hydroxy-5-methylene-3-(1-piperidinylamino)- ; 2-Hydroxy-5-methylene-3-(piperidin-1-ylamino)cyclopent-2-en-1-one and 2-Cyclopenten-1-one, 2-hydroxy-5-methylene-3-piperidinoamino- . It is a moderate toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 166.3°C |
| Safety Data | |
 |
|
