| Identification | |
| Name: | Cyclopropanecarboxylicacid, 2-butoxy-, butyl ester |
| Synonyms: | Butyl 2-butoxycyclopropanecarboxylate;cyclopropanecarboxylic acid, 2-butoxy-, butyl ester |
| CAS: | 63937-32-6 |
| Molecular Formula: | C12H22 O3 |
| Molecular Weight: | 214.34 |
| InChI: | InChI=1/C12H22O3/c1-3-5-7-14-11-9-10(11)12(13)15-8-6-4-2/h10-11H,3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 105.1°C |
| Boiling Point: | 264.6°Cat760mmHg |
| Density: | 0.97g/cm3 |
| Refractive index: | 1.452 |
| Specification: |
The extinguishing agent of Butyl-2-butoxycyclopropane-1-carboxylate (CAS NO.63937-32-6) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 105.1°C |
| Safety Data | |
 |
|
